CAS 1469780-16-2 is the registry number for 3-(Bis(4-bromophenyl)amino)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-N-(4-bromophenyl)anilino)benzaldehyde (CAS 1469780-16-2) is a chemical compound with the molecular formula C19H13Br2NO and a molecular weight of 431.1 g/mol. IUPAC name: 3-(4-bromo-N-(4-bromophenyl)anilino)benzaldehyde. InChIKey: UWDSRFWDWCBTTJ-UHFFFAOYSA-N.
| Molecular formula | C19H13Br2NO |
|---|---|
| Molecular weight | 431.1 g/mol |
| IUPAC name | 3-(4-bromo-N-(4-bromophenyl)anilino)benzaldehyde |
| InChIKey | UWDSRFWDWCBTTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)C=O |
Computed by PubChem (NCBI)