Products 14698-07-8
CAS 14698-07-8 is the registry number for Tipepidine (citrate). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(dithiophen-2-ylmethylidene)-1-methylpiperidine;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 14698-07-8) is a chemical compound with the molecular formula C21H25NO7S2 and a molecular weight of 467.6 g/mol. IUPAC name: 3-(dithiophen-2-ylmethylidene)-1-methylpiperidine;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: WQOYJMWVNIGIQR-UHFFFAOYSA-N.
| Molecular formula | C21H25NO7S2 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | 3-(dithiophen-2-ylmethylidene)-1-methylpiperidine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | WQOYJMWVNIGIQR-UHFFFAOYSA-N |
| SMILES | CN1CCCC(=C(C2=CC=CS2)C3=CC=CS3)C1.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)