CAS 146986-45-0 is the registry number for 1,2-Di-O-acetyl-3,5-di-O-benzyl-D-xylofuranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3R,4S,5R)-2-acetyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (CAS 146986-45-0) is a chemical compound with the molecular formula C23H26O7 and a molecular weight of 414.4 g/mol. IUPAC name: [(3R,4S,5R)-2-acetyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate. InChIKey: QQEKCYXHFJIXJS-VNYJYPEVSA-N.
| Molecular formula | C23H26O7 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | [(3R,4S,5R)-2-acetyloxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| InChIKey | QQEKCYXHFJIXJS-VNYJYPEVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@H](OC1OC(=O)C)COCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)