CAS 146997-97-9 is the registry number for Pyridine-2,6-diamine sulfate 95+%. Offered by: Ambeed. Available pack sizes: 5g, 25g.
Pyridine-2,6-diamine;sulfuric acid (CAS 146997-97-9) is a chemical compound with the molecular formula C5H9N3O4S and a molecular weight of 207.21 g/mol. IUPAC name: pyridine-2,6-diamine;sulfuric acid. InChIKey: OSWQRJFRLQAWTI-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O4S |
|---|---|
| Molecular weight | 207.21 g/mol |
| IUPAC name | pyridine-2,6-diamine;sulfuric acid |
| InChIKey | OSWQRJFRLQAWTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)