Products 146997-97-9

CAS 146997-97-9 is the registry number for Pyridine-2,6-diamine sulfate 95+%. Offered by: Ambeed. Available pack sizes: 5g, 25g.

Structural formula: {0} (CAS {1})

Pyridine-2,6-diamine;sulfuric acid (CAS 146997-97-9) is a chemical compound with the molecular formula C5H9N3O4S and a molecular weight of 207.21 g/mol. IUPAC name: pyridine-2,6-diamine;sulfuric acid. InChIKey: OSWQRJFRLQAWTI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9N3O4S
Molecular weight207.21 g/mol
IUPAC namepyridine-2,6-diamine;sulfuric acid
InChIKeyOSWQRJFRLQAWTI-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1)N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)