CAS 1470024-53-3 is the registry number for Ethyl 6,7-difluoro-1-((1R,2S)-2-fluorocyclopropyl)-4-oxo-1,4-dihydroquinoline-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate (CAS 1470024-53-3) is a chemical compound with the molecular formula C15H12F3NO3 and a molecular weight of 311.25 g/mol. IUPAC name: ethyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate. InChIKey: SBELZMDYRLGMIF-WCQYABFASA-N.
| Molecular formula | C15H12F3NO3 |
|---|---|
| Molecular weight | 311.25 g/mol |
| IUPAC name | ethyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate |
| InChIKey | SBELZMDYRLGMIF-WCQYABFASA-N |
| SMILES | CCOC(=O)C1=CN(C2=CC(=C(C=C2C1=O)F)F)[C@@H]3C[C@@H]3F |
Computed by PubChem (NCBI)