CAS 94242-51-0 appears in our catalog under these names: Moxifloxacin Impurity 17, 1-Cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid Ethyl Ester, >95% (HPLC), 1-CYCLOPROPYL-6,7,8-TRIFLUORO-1,4-DIHYDRO-4-OXO-3-QUINOLINECARBOXYLIC ACID ETHYL ESTER, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg.
Ethyl 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate (CAS 94242-51-0) is a chemical compound with the molecular formula C15H12F3NO3 and a molecular weight of 311.25 g/mol. IUPAC name: ethyl 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate. InChIKey: FGICMAMEHORFNK-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO3 |
|---|---|
| Molecular weight | 311.25 g/mol |
| IUPAC name | ethyl 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
| InChIKey | FGICMAMEHORFNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C2=C(C(=C(C=C2C1=O)F)F)F)C3CC3 |
Computed by PubChem (NCBI)