CAS 147027-64-3 appears in our catalog under these names: 2,2'-Dithiobis(6-fluorobenzoic acid), 95%, 2,2'–Dithiobis(6–fluorobenzoic Acid), 2,2'-Dithiobis(6-fluorobenzoic Acid), >98.0%(HPLC)(T), 6,6'-Disulfanediylbis(2-fluorobenzoic acid), 2,2'-DITHIOBIS(6-FLUOROBENZOIC ACID), 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg.
2-[(2-carboxy-3-fluorophenyl)disulfanyl]-6-fluorobenzoic acid (CAS 147027-64-3) is a chemical compound with the molecular formula C14H8F2O4S2 and a molecular weight of 342.3 g/mol. IUPAC name: 2-[(2-carboxy-3-fluorophenyl)disulfanyl]-6-fluorobenzoic acid. InChIKey: QEONSZINEMHFPH-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O4S2 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 2-[(2-carboxy-3-fluorophenyl)disulfanyl]-6-fluorobenzoic acid |
| InChIKey | QEONSZINEMHFPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)SSC2=CC=CC(=C2C(=O)O)F)C(=O)O)F |
Computed by PubChem (NCBI)