CAS 147028-85-1 appears in our catalog under these names: 3-Ethyl Adenine-d5 (2% d0), 3-Ethyl-3H-purin-6-amine-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3-(1,1,2,2,2-pentadeuterioethyl)-7H-purin-6-imine (CAS 147028-85-1) is a chemical compound with the molecular formula C7H9N5 and a molecular weight of 168.21 g/mol. IUPAC name: 3-(1,1,2,2,2-pentadeuterioethyl)-7H-purin-6-imine. InChIKey: XAZTXNQITCBSCJ-ZBJDZAJPSA-N.
| Molecular formula | C7H9N5 |
|---|---|
| Molecular weight | 168.21 g/mol |
| IUPAC name | 3-(1,1,2,2,2-pentadeuterioethyl)-7H-purin-6-imine |
| InChIKey | XAZTXNQITCBSCJ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=NC(=N)C2=C1N=CN2 |
Computed by PubChem (NCBI)