CAS 147030-50-0 appears in our catalog under these names: Amiodarone EP Impurity F, De(diethylaminoethyl-5-iodo) Amiodarone, >95% (HPLC), L-6424, 97%, (2-Butylbenzofuran-3-yl)(4-hydroxy-3-iodophenyl)methanone, L–6424. Offered by: Chemat Brand, TRC, AmBeed, Mikromol, GLPBio. Available pack sizes: on request, 100mg, 25mg, 50mg, 1g, 4x25mg, 10mg, 5mg.
(2-butyl-1-benzofuran-3-yl)-(4-hydroxy-3-iodophenyl)methanone (CAS 147030-50-0) is a chemical compound with the molecular formula C19H17IO3 and a molecular weight of 420.2 g/mol. IUPAC name: (2-butyl-1-benzofuran-3-yl)-(4-hydroxy-3-iodophenyl)methanone. InChIKey: SPJWRQCARFHMEB-UHFFFAOYSA-N.
| Molecular formula | C19H17IO3 |
|---|---|
| Molecular weight | 420.2 g/mol |
| IUPAC name | (2-butyl-1-benzofuran-3-yl)-(4-hydroxy-3-iodophenyl)methanone |
| InChIKey | SPJWRQCARFHMEB-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C=C3)O)I |
Computed by PubChem (NCBI)