CAS 147086-79-1 appears in our catalog under these names: (6S)-5,6-Dihydro-6-methyl-4h-thieno[2,3-b]thiopyran-4-one, 95%, 5,6–Dihydro–6–methyl–4H–thieno(2,3–b)thiopyran–4–one, (S)-6-Methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-one, 95%, 95%, (S)-6-Methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-one, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g.
(6S)-6-methyl-5,6-dihydrothieno[2,3-b]thiopyran-4-one (CAS 147086-79-1) is a chemical compound with the molecular formula C8H8OS2 and a molecular weight of 184.3 g/mol. IUPAC name: (6S)-6-methyl-5,6-dihydrothieno[2,3-b]thiopyran-4-one. InChIKey: FLJFMDYYNMNASJ-YFKPBYRVSA-N.
| Molecular formula | C8H8OS2 |
|---|---|
| Molecular weight | 184.3 g/mol |
| IUPAC name | (6S)-6-methyl-5,6-dihydrothieno[2,3-b]thiopyran-4-one |
| InChIKey | FLJFMDYYNMNASJ-YFKPBYRVSA-N |
| SMILES | C[C@H]1CC(=O)C2=C(S1)SC=C2 |
Computed by PubChem (NCBI)