CAS 147086-83-7 appears in our catalog under these names: Dorzolamide Impurity 20, Dorzolamide Impurity 30, Dorzolamide Impurity 12, Acetamide, N-(5,6-dihydro-6-methyl-7,7-dioxido-4H-thieno[2,3-b]thiopyran-4-yl)-, (4S-trans)-, 98%, 98%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide (CAS 147086-83-7) is a chemical compound with the molecular formula C10H13NO3S2 and a molecular weight of 259.3 g/mol. IUPAC name: N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide. InChIKey: WJXLCNFSFHSWMJ-RCOVLWMOSA-N.
| Molecular formula | C10H13NO3S2 |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide |
| InChIKey | WJXLCNFSFHSWMJ-RCOVLWMOSA-N |
| SMILES | C[C@H]1C[C@@H](C2=C(S1(=O)=O)SC=C2)NC(=O)C |
Computed by PubChem (NCBI)