CAS 147126-64-5 appears in our catalog under these names: (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylate, Lamivudine Impurity 16, Lamivudine Impurity 6. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, on request.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylate (CAS 147126-64-5) is a chemical compound with the molecular formula C14H24O4S and a molecular weight of 288.40 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylate. InChIKey: KXKDZLRTIFHOHW-OJROKELRSA-N.
| Molecular formula | C14H24O4S |
|---|---|
| Molecular weight | 288.40 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylate |
| InChIKey | KXKDZLRTIFHOHW-OJROKELRSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@H]2O[C@H](CS2)O)C(C)C |
Computed by PubChem (NCBI)