Products 1471262-29-9
CAS 1471262-29-9 is the registry number for 1,2-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidazole, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1,2-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole (CAS 1471262-29-9) is a chemical compound with the molecular formula C15H21BN2O2 and a molecular weight of 272.15 g/mol. IUPAC name: 1,2-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole. InChIKey: DDCSNGVKHNWENQ-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O2 |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 1,2-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
| InChIKey | DDCSNGVKHNWENQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=C(N3C)C |
Computed by PubChem (NCBI)