CAS 1607838-36-7 is the registry number for 1-Ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1607838-36-7) is a chemical compound with the molecular formula C15H21BN2O2 and a molecular weight of 272.15 g/mol. IUPAC name: 1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: KKIWBVRSQLELDZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O2 |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | KKIWBVRSQLELDZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3CC |
Computed by PubChem (NCBI)