CAS 147283-96-3 appears in our catalog under these names: tert-Butyl((4-iodophenyl)methoxy)dimethylsilane, 95-<97%, tert-Butyl((4-iodophenyl)methoxy)dimethylsilane. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 50mg, 0,5g.
Tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane (CAS 147283-96-3) is a chemical compound with the molecular formula C13H21IOSi and a molecular weight of 348.29 g/mol. IUPAC name: tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane. InChIKey: HJACHJOGIDAXCP-UHFFFAOYSA-N.
| Molecular formula | C13H21IOSi |
|---|---|
| Molecular weight | 348.29 g/mol |
| IUPAC name | tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane |
| InChIKey | HJACHJOGIDAXCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC=C(C=C1)I |
Computed by PubChem (NCBI)