CAS 147331-52-0 is the registry number for (betaR)-beta-Hydroxy-L-tyrosine. Offered by: TRC. Available pack sizes: 50mg.
(2S,3R)-2-amino-3-hydroxy-3-(4-hydroxyphenyl)propanoic acid (CAS 147331-52-0) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxyphenyl)propanoic acid. InChIKey: RKCRKDKQUDBXAU-JGVFFNPUSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | RKCRKDKQUDBXAU-JGVFFNPUSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)