Products 147351-85-7
CAS 147351-85-7 is the registry number for Calcitriol Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (CAS 147351-85-7) is a chemical compound with the molecular formula C18H32O and a molecular weight of 264.4 g/mol. IUPAC name: (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol. InChIKey: XLIUMZXJHFBIDC-DFBDCSAJSA-N.
| Molecular formula | C18H32O |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| InChIKey | XLIUMZXJHFBIDC-DFBDCSAJSA-N |
| SMILES | C[C@H](CCC=C(C)C)[C@H]1CC[C@@H]2[C@@]1(CCC[C@@H]2O)C |
Computed by PubChem (NCBI)