Products 147411-70-9
CAS 147411-70-9 appears in our catalog under these names: (Z)-Pyriminobac-methyl, (Z)-Pyriminobac-methyl 10 µg/mL in Cyclohexane, (Z)-Pyriminobac-methyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1ml, 1x10mg, 1x5ml.
Methyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-[(Z)-N-methoxy-C-methylcarbonimidoyl]benzoate (CAS 147411-70-9) is a chemical compound with the molecular formula C17H19N3O6 and a molecular weight of 361.3 g/mol. IUPAC name: methyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-[(Z)-N-methoxy-C-methylcarbonimidoyl]benzoate. InChIKey: USSIUIGPBLPCDF-JMIUGGIZSA-N.
| Molecular formula | C17H19N3O6 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | methyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-[(Z)-N-methoxy-C-methylcarbonimidoyl]benzoate |
| InChIKey | USSIUIGPBLPCDF-JMIUGGIZSA-N |
| SMILES | C/C(=N/OC)/C1=C(C(=CC=C1)OC2=NC(=CC(=N2)OC)OC)C(=O)OC |
Computed by PubChem (NCBI)