CAS 14742-36-0 appears in our catalog under these names: 3,4,5,6-Tetrafluorosalicylic acid, 95%, 2,3,4,5-Tetrafluoro-6-hydroxybenzoic acid, 98%, 3,4,5,6–Tetrafluorosalicylic Acid, 3,4,5,6-Tetrafluorosalicylic Acid, >98.0%(T), 2,3,4,5-Tetrafluoro-6-hydroxybenzoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg.
2,3,4,5-tetrafluoro-6-hydroxybenzoic acid (CAS 14742-36-0) is a chemical compound with the molecular formula C7H2F4O3 and a molecular weight of 210.08 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-hydroxybenzoic acid. InChIKey: WKYGDMSOKGXAAY-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O3 |
|---|---|
| Molecular weight | 210.08 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-hydroxybenzoic acid |
| InChIKey | WKYGDMSOKGXAAY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)O)C(=O)O |
Computed by PubChem (NCBI)