Products 14750-21-1
CAS 14750-21-1 is the registry number for VHC-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 3-[(2,4-dichlorophenyl)methyl]-2-oxo-1H-indole-3-carboxylate (CAS 14750-21-1) is a chemical compound with the molecular formula C18H15Cl2NO3 and a molecular weight of 364.2 g/mol. IUPAC name: ethyl 3-[(2,4-dichlorophenyl)methyl]-2-oxo-1H-indole-3-carboxylate. InChIKey: DWBPCKNPUQQHND-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl2NO3 |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | ethyl 3-[(2,4-dichlorophenyl)methyl]-2-oxo-1H-indole-3-carboxylate |
| InChIKey | DWBPCKNPUQQHND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C2=CC=CC=C2NC1=O)CC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)