Products 147503-88-6
CAS 147503-88-6 is the registry number for Ethyl 3-iodo-1h-pyrrolo[2,3-c]pyridine-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 3-iodo-1H-pyrrolo[2,3-c]pyridine-5-carboxylate (CAS 147503-88-6) is a chemical compound with the molecular formula C10H9IN2O2 and a molecular weight of 316.09 g/mol. IUPAC name: ethyl 3-iodo-1H-pyrrolo[2,3-c]pyridine-5-carboxylate. InChIKey: VXSNXVLHVWJQNF-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O2 |
|---|---|
| Molecular weight | 316.09 g/mol |
| IUPAC name | ethyl 3-iodo-1H-pyrrolo[2,3-c]pyridine-5-carboxylate |
| InChIKey | VXSNXVLHVWJQNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C2C(=C1)C(=CN2)I |
Computed by PubChem (NCBI)