CAS 1363381-60-5 is the registry number for Methyl 5-iodo-1-methyl-1h-indazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 5-iodo-1-methylindazole-3-carboxylate (CAS 1363381-60-5) is a chemical compound with the molecular formula C10H9IN2O2 and a molecular weight of 316.09 g/mol. IUPAC name: methyl 5-iodo-1-methylindazole-3-carboxylate. InChIKey: HLUCFIRDCLUDBD-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O2 |
|---|---|
| Molecular weight | 316.09 g/mol |
| IUPAC name | methyl 5-iodo-1-methylindazole-3-carboxylate |
| InChIKey | HLUCFIRDCLUDBD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)I)C(=N1)C(=O)OC |
Computed by PubChem (NCBI)