CAS 147508-06-3 is the registry number for KF-19418. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-diphenyl-1H-pyrazolo[4,5-c][1,8]naphthyridin-4-one (CAS 147508-06-3) is a chemical compound with the molecular formula C21H14N4O and a molecular weight of 338.4 g/mol. IUPAC name: 3,5-diphenyl-1H-pyrazolo[4,5-c][1,8]naphthyridin-4-one. InChIKey: UUTQKSICTCJBNB-UHFFFAOYSA-N.
| Molecular formula | C21H14N4O |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 3,5-diphenyl-1H-pyrazolo[4,5-c][1,8]naphthyridin-4-one |
| InChIKey | UUTQKSICTCJBNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3=C2C(=O)N(C4=C3C=CC=N4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)