CAS 147566-76-5 is the registry number for 5,5'-((1,3-Phenylenebis(methylene))bis(oxy))diisophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[3-[(3,5-dicarboxyphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarboxylic acid (CAS 147566-76-5) is a chemical compound with the molecular formula C24H18O10 and a molecular weight of 466.4 g/mol. IUPAC name: 5-[[3-[(3,5-dicarboxyphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarboxylic acid. InChIKey: JIFHUSQXUBUIEB-UHFFFAOYSA-N.
| Molecular formula | C24H18O10 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | 5-[[3-[(3,5-dicarboxyphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarboxylic acid |
| InChIKey | JIFHUSQXUBUIEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)COC2=CC(=CC(=C2)C(=O)O)C(=O)O)COC3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)