Products 1476065-80-1
CAS 1476065-80-1 is the registry number for 5-(2-(2-Azidoethoxy)acetyl)-2,2-dimethyl-1,3-dioxane-4,6-dione. Offered by: TRC. Available pack sizes: 250mg.
5-[2-(2-azidoethoxy)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 1476065-80-1) is a chemical compound with the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. IUPAC name: 5-[2-(2-azidoethoxy)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: VJXPDVDCITWBHC-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O6 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 5-[2-(2-azidoethoxy)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | VJXPDVDCITWBHC-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C(=O)COCCN=[N+]=[N-])C |
Computed by PubChem (NCBI)