Products 147672-00-2
CAS 147672-00-2 is the registry number for Triethoxyphosphine-d15. Offered by: Biosynth. Available pack sizes: 100mg.
Tris(1,1,2,2,2-pentadeuterioethyl) phosphite (CAS 147672-00-2) is a chemical compound with the molecular formula C6H15O3P and a molecular weight of 181.25 g/mol. IUPAC name: tris(1,1,2,2,2-pentadeuterioethyl) phosphite. InChIKey: BDZBKCUKTQZUTL-NLBPYYKNSA-N.
| Molecular formula | C6H15O3P |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | tris(1,1,2,2,2-pentadeuterioethyl) phosphite |
| InChIKey | BDZBKCUKTQZUTL-NLBPYYKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)