CAS 1476722-39-0 is the registry number for 1-(3-Cyclopropyl-1,2,4-thiadiazol-5-yl)-1H-imidazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)imidazole-4-carboxylic acid (CAS 1476722-39-0) is a chemical compound with the molecular formula C9H8N4O2S and a molecular weight of 236.25 g/mol. IUPAC name: 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)imidazole-4-carboxylic acid. InChIKey: JJEOZOSTYLXIMU-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2S |
|---|---|
| Molecular weight | 236.25 g/mol |
| IUPAC name | 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)imidazole-4-carboxylic acid |
| InChIKey | JJEOZOSTYLXIMU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NSC(=N2)N3C=C(N=C3)C(=O)O |
Computed by PubChem (NCBI)