Products 147696-46-6
CAS 147696-46-6 is the registry number for ZD-6169. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-N-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (CAS 147696-46-6) is a chemical compound with the molecular formula C17H14F3NO3 and a molecular weight of 337.29 g/mol. IUPAC name: (2S)-N-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide. InChIKey: LVEDGSIMCSQNNX-INIZCTEOSA-N.
| Molecular formula | C17H14F3NO3 |
|---|---|
| Molecular weight | 337.29 g/mol |
| IUPAC name | (2S)-N-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| InChIKey | LVEDGSIMCSQNNX-INIZCTEOSA-N |
| SMILES | C[C@](C(=O)NC1=CC=C(C=C1)C(=O)C2=CC=CC=C2)(C(F)(F)F)O |
Computed by PubChem (NCBI)