CAS 147699-67-0 is the registry number for 4,5-Bis(phenylthio)phthalonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4,5-bis(phenylsulfanyl)benzene-1,2-dicarbonitrile (CAS 147699-67-0) is a chemical compound with the molecular formula C20H12N2S2 and a molecular weight of 344.5 g/mol. IUPAC name: 4,5-bis(phenylsulfanyl)benzene-1,2-dicarbonitrile. InChIKey: XOHYJKFIHOYQKA-UHFFFAOYSA-N.
| Molecular formula | C20H12N2S2 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | 4,5-bis(phenylsulfanyl)benzene-1,2-dicarbonitrile |
| InChIKey | XOHYJKFIHOYQKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C=C(C(=C2)C#N)C#N)SC3=CC=CC=C3 |
Computed by PubChem (NCBI)