Products 147714-63-4
CAS 147714-63-4 is the registry number for Prehumulone. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(4-methylpentanoyl)cyclohexa-2,4-dien-1-one (CAS 147714-63-4) is a chemical compound with the molecular formula C22H32O5 and a molecular weight of 376.5 g/mol. IUPAC name: 3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(4-methylpentanoyl)cyclohexa-2,4-dien-1-one. InChIKey: OIXWZZRPUMLSMY-UHFFFAOYSA-N.
| Molecular formula | C22H32O5 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(4-methylpentanoyl)cyclohexa-2,4-dien-1-one |
| InChIKey | OIXWZZRPUMLSMY-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(=O)C1=C(C(=C(C(C1=O)(CC=C(C)C)O)O)CC=C(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Prehumulone, Prehumulone/Adprehumulone