CAS 1477485-46-3 is the registry number for DAAQ–TFP COF. Offered by: GLPBio. Available pack sizes: 100mg, 500mg.
2,6-diaminoanthracene-9,10-dione;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde (CAS 1477485-46-3) is a chemical compound with the molecular formula C23H16N2O8 and a molecular weight of 448.4 g/mol. IUPAC name: 2,6-diaminoanthracene-9,10-dione;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde. InChIKey: IQLGOCLHEIYUAL-UHFFFAOYSA-N.
| Molecular formula | C23H16N2O8 |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | 2,6-diaminoanthracene-9,10-dione;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde |
| InChIKey | IQLGOCLHEIYUAL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C3=C(C2=O)C=C(C=C3)N.C(=O)C1=C(C(=C(C(=C1O)C=O)O)C=O)O |
Computed by PubChem (NCBI)