Products 1477494-97-5
CAS 1477494-97-5 appears in our catalog under these names: Diphenyl Phosphate-d10, >95% (HPLC), Diphenyl Phosphate–d10, Diphenyl Phosphate-d10, 99.74%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 1 mg.
Bis(2,3,4,5,6-pentadeuteriophenyl) hydrogen phosphate (CAS 1477494-97-5) is a chemical compound with the molecular formula C12H11O4P and a molecular weight of 260.25 g/mol. IUPAC name: bis(2,3,4,5,6-pentadeuteriophenyl) hydrogen phosphate. InChIKey: ASMQGLCHMVWBQR-LHNTUAQVSA-N.
| Molecular formula | C12H11O4P |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentadeuteriophenyl) hydrogen phosphate |
| InChIKey | ASMQGLCHMVWBQR-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OP(=O)(O)OC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)