CAS 147751-31-3 appears in our catalog under these names: HDL376, 98%, HDL376, 1-(5-chloro-2-methylphenyl)-3-(2-methylpropyl)thiourea, HDL376, 98.62%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 50mg, 10mg, 25mg, 100mg, 25 mg, 5 mg.
1-(5-chloro-2-methylphenyl)-3-(2-methylpropyl)thiourea (CAS 147751-31-3) is a chemical compound with the molecular formula C12H17ClN2S and a molecular weight of 256.80 g/mol. IUPAC name: 1-(5-chloro-2-methylphenyl)-3-(2-methylpropyl)thiourea. InChIKey: CVLONJGXRCEARL-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2S |
|---|---|
| Molecular weight | 256.80 g/mol |
| IUPAC name | 1-(5-chloro-2-methylphenyl)-3-(2-methylpropyl)thiourea |
| InChIKey | CVLONJGXRCEARL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)NC(=S)NCC(C)C |
Computed by PubChem (NCBI)