CAS 147762-53-6 appears in our catalog under these names: Fmoc-o-phospho-l-tyrosine, 98%, Fmoc–O–Phospho–Tyr–OH, Fmoc-L-Tyr(PO3H2)-OH, Fmoc-O-phospho-L-tyrosine, Fmoc-Tyr(H2PO3)-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 250mg, 0,5g, 2g, 10g, 100mg, 25g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phosphonooxyphenyl)propanoic acid (CAS 147762-53-6) is a chemical compound with the molecular formula C24H22NO8P and a molecular weight of 483.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phosphonooxyphenyl)propanoic acid. InChIKey: AMXUJIHSMANWDW-QFIPXVFZSA-N.
| Molecular formula | C24H22NO8P |
|---|---|
| Molecular weight | 483.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phosphonooxyphenyl)propanoic acid |
| InChIKey | AMXUJIHSMANWDW-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)OP(=O)(O)O)C(=O)O |
Computed by PubChem (NCBI)