Products 1477640-96-2
CAS 1477640-96-2 is the registry number for 3-((2-(6-Chloro-1H-indol-1-yl)ethyl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine (CAS 1477640-96-2) is a chemical compound with the molecular formula C14H17ClN2O2S and a molecular weight of 312.8 g/mol. IUPAC name: N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine. InChIKey: AZAVKPYYVVFTAM-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O2S |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | N-[2-(6-chloroindol-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
| InChIKey | AZAVKPYYVVFTAM-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NCCN2C=CC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)