Products 1477719-11-1

CAS 1477719-11-1 is the registry number for 2-(5-Bromo-1,2,4-thiadiazol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-bromo-1,2,4-thiadiazol-3-yl)acetic acid (CAS 1477719-11-1) is a chemical compound with the molecular formula C4H3BrN2O2S and a molecular weight of 223.05 g/mol. IUPAC name: 2-(5-bromo-1,2,4-thiadiazol-3-yl)acetic acid. InChIKey: HOKLHFYXFCUMKA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3BrN2O2S
Molecular weight223.05 g/mol
IUPAC name2-(5-bromo-1,2,4-thiadiazol-3-yl)acetic acid
InChIKeyHOKLHFYXFCUMKA-UHFFFAOYSA-N
SMILESC(C1=NSC(=N1)Br)C(=O)O

Computed by PubChem (NCBI)