CAS 1477759-28-6 is the registry number for 9-(4-(4-Chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl)-9H-carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole (CAS 1477759-28-6) is a chemical compound with the molecular formula C27H17ClN4 and a molecular weight of 432.9 g/mol. IUPAC name: 9-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole. InChIKey: GEUNEMWSELPUFS-UHFFFAOYSA-N.
| Molecular formula | C27H17ClN4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | 9-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| InChIKey | GEUNEMWSELPUFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=C(C=C3)N4C5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)