CAS 147782-19-2 appears in our catalog under these names: DCG IV, >95% (HPLC), DCG-IV, DCG IV, DCG IV, DCG-IV, 99.0%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 25mg, 1 mg.
Trans-(1R,2R)-3-[(S)-amino(carboxy)methyl]cyclopropane-1,2-dicarboxylic acid (CAS 147782-19-2) is a chemical compound with the molecular formula C7H9NO6 and a molecular weight of 203.15 g/mol. IUPAC name: trans-(1R,2R)-3-[(S)-amino(carboxy)methyl]cyclopropane-1,2-dicarboxylic acid. InChIKey: MATPZHBYOVDBLI-JJYYJPOSSA-N.
| Molecular formula | C7H9NO6 |
|---|---|
| Molecular weight | 203.15 g/mol |
| IUPAC name | trans-(1R,2R)-3-[(S)-amino(carboxy)methyl]cyclopropane-1,2-dicarboxylic acid |
| InChIKey | MATPZHBYOVDBLI-JJYYJPOSSA-N |
| SMILES | [C@@H]1([C@@H](C1[C@@H](C(=O)O)N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)