CAS 147821-49-6 appears in our catalog under these names: Niazimicin, Niazimicin, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
O-ethyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate (CAS 147821-49-6) is a chemical compound with the molecular formula C16H23NO6S and a molecular weight of 357.4 g/mol. IUPAC name: O-ethyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate. InChIKey: JOSHUAQJVMGTGS-NBUQLFNLSA-N.
| Molecular formula | C16H23NO6S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | O-ethyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate |
| InChIKey | JOSHUAQJVMGTGS-NBUQLFNLSA-N |
| SMILES | CCOC(=S)NCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O |
Computed by PubChem (NCBI)