CAS 1478364-68-9 appears in our catalog under these names: 4-(((2E)-2-(Aminomethyl)-3-fluoro-2-propen-1-yl)oxy)-N-(1,1-dimethylethyl)-benzamide Hydrochloride (1:1), PXS–4728A, PXS-4728A, PXS 4728A, PXS-4728A 97%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 2mg.
4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-tert-butylbenzamide;hydrochloride (CAS 1478364-68-9) is a chemical compound with the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. IUPAC name: 4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-tert-butylbenzamide;hydrochloride. InChIKey: AEMZEDNMNLIDSL-YGCVIUNWSA-N.
| Molecular formula | C15H22ClFN2O2 |
|---|---|
| Molecular weight | 316.80 g/mol |
| IUPAC name | 4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-N-tert-butylbenzamide;hydrochloride |
| InChIKey | AEMZEDNMNLIDSL-YGCVIUNWSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=C(C=C1)OC/C(=C/F)/CN.Cl |
Computed by PubChem (NCBI)