CAS 1478364-87-2 is the registry number for PXS-4681A, 99.40%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 10 mg, 25 mg.
4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride (CAS 1478364-87-2) is a chemical compound with the molecular formula C10H14ClFN2O3S and a molecular weight of 296.75 g/mol. IUPAC name: 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride. InChIKey: VBGNJMUEMDYZJJ-HGKIGUAWSA-N.
| Molecular formula | C10H14ClFN2O3S |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride |
| InChIKey | VBGNJMUEMDYZJJ-HGKIGUAWSA-N |
| SMILES | C1=CC(=CC=C1OC/C(=C\F)/CN)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)