Products 1478364-87-2

CAS 1478364-87-2 is the registry number for PXS-4681A, 99.40%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride (CAS 1478364-87-2) is a chemical compound with the molecular formula C10H14ClFN2O3S and a molecular weight of 296.75 g/mol. IUPAC name: 4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride. InChIKey: VBGNJMUEMDYZJJ-HGKIGUAWSA-N.

Identity
Molecular formulaC10H14ClFN2O3S
Molecular weight296.75 g/mol
IUPAC name4-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]benzenesulfonamide;hydrochloride
InChIKeyVBGNJMUEMDYZJJ-HGKIGUAWSA-N
SMILESC1=CC(=CC=C1OC/C(=C\F)/CN)S(=O)(=O)N.Cl

Computed by PubChem (NCBI)