CAS 1478403-00-7 is the registry number for 1,3-Bis(4-bromophenyl)guanidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-bis(4-bromophenyl)guanidine;hydrochloride (CAS 1478403-00-7) is a chemical compound with the molecular formula C13H12Br2ClN3 and a molecular weight of 405.51 g/mol. IUPAC name: 1,2-bis(4-bromophenyl)guanidine;hydrochloride. InChIKey: DYNOLLFJKQIVRQ-UHFFFAOYSA-N.
| Molecular formula | C13H12Br2ClN3 |
|---|---|
| Molecular weight | 405.51 g/mol |
| IUPAC name | 1,2-bis(4-bromophenyl)guanidine;hydrochloride |
| InChIKey | DYNOLLFJKQIVRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=NC2=CC=C(C=C2)Br)N)Br.Cl |
Computed by PubChem (NCBI)