Products 1478403-00-7

CAS 1478403-00-7 is the registry number for 1,3-Bis(4-bromophenyl)guanidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,2-bis(4-bromophenyl)guanidine;hydrochloride (CAS 1478403-00-7) is a chemical compound with the molecular formula C13H12Br2ClN3 and a molecular weight of 405.51 g/mol. IUPAC name: 1,2-bis(4-bromophenyl)guanidine;hydrochloride. InChIKey: DYNOLLFJKQIVRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12Br2ClN3
Molecular weight405.51 g/mol
IUPAC name1,2-bis(4-bromophenyl)guanidine;hydrochloride
InChIKeyDYNOLLFJKQIVRQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=NC2=CC=C(C=C2)Br)N)Br.Cl

Computed by PubChem (NCBI)