CAS 147857-42-9 appears in our catalog under these names: (H-Hocys-ome)2 dihydrochloride, 95%, (H-HoCys-OMe)2 2HCL 95%, (H-Hocys-ome)2 2hcl, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl (2S)-2-amino-4-[[(3S)-3-amino-4-methoxy-4-oxobutyl]disulfanyl]butanoate;dihydrochloride (CAS 147857-42-9) is a chemical compound with the molecular formula C10H22Cl2N2O4S2 and a molecular weight of 369.3 g/mol. IUPAC name: methyl (2S)-2-amino-4-[[(3S)-3-amino-4-methoxy-4-oxobutyl]disulfanyl]butanoate;dihydrochloride. InChIKey: MONLWIYLANNRGT-FOMWZSOGSA-N.
| Molecular formula | C10H22Cl2N2O4S2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | methyl (2S)-2-amino-4-[[(3S)-3-amino-4-methoxy-4-oxobutyl]disulfanyl]butanoate;dihydrochloride |
| InChIKey | MONLWIYLANNRGT-FOMWZSOGSA-N |
| SMILES | COC(=O)[C@H](CCSSCC[C@@H](C(=O)OC)N)N.Cl.Cl |
Computed by PubChem (NCBI)