CAS 1478872-37-5 is the registry number for 1-(Propan-2-yl)-2-(trifluoromethyl)-1H-1,3-benzodiazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-propan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine (CAS 1478872-37-5) is a chemical compound with the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. IUPAC name: 1-propan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine. InChIKey: JJPNMPTUEKCZQC-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N3 |
|---|---|
| Molecular weight | 243.23 g/mol |
| IUPAC name | 1-propan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine |
| InChIKey | JJPNMPTUEKCZQC-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)N)N=C1C(F)(F)F |
Computed by PubChem (NCBI)