Products 147923-04-4
CAS 147923-04-4 is the registry number for CGS 24592. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylamino)propanoyl]amino]propanoic acid (CAS 147923-04-4) is a chemical compound with the molecular formula C19H23N2O6P and a molecular weight of 406.4 g/mol. IUPAC name: 3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylamino)propanoyl]amino]propanoic acid. InChIKey: MVRLTBIHUWUGAR-KRWDZBQOSA-N.
| Molecular formula | C19H23N2O6P |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylamino)propanoyl]amino]propanoic acid |
| InChIKey | MVRLTBIHUWUGAR-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@@H](C(=O)NCCC(=O)O)NCP(=O)(O)O |
Computed by PubChem (NCBI)