CAS 1479681-48-5 is the registry number for 5-(2,4-Dimethylthiazol-5-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine (CAS 1479681-48-5) is a chemical compound with the molecular formula C7H8N4S2 and a molecular weight of 212.3 g/mol. IUPAC name: 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine. InChIKey: WOXDGNYZXQQOSM-UHFFFAOYSA-N.
| Molecular formula | C7H8N4S2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WOXDGNYZXQQOSM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=NN=C(S2)N |
Computed by PubChem (NCBI)