CAS 1479797-03-9 appears in our catalog under these names: 1-(Butan-2-yl)-2-(trifluoromethyl)-1H-1,3-benzodiazol-5-amine, 95%, 1-(Butan-2-yl)-2-(trifluoromethyl)-1H-1,3-benzodiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-butan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine (CAS 1479797-03-9) is a chemical compound with the molecular formula C12H14F3N3 and a molecular weight of 257.25 g/mol. IUPAC name: 1-butan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine. InChIKey: LSLNUBCKZZOIQB-UHFFFAOYSA-N.
| Molecular formula | C12H14F3N3 |
|---|---|
| Molecular weight | 257.25 g/mol |
| IUPAC name | 1-butan-2-yl-2-(trifluoromethyl)benzimidazol-5-amine |
| InChIKey | LSLNUBCKZZOIQB-UHFFFAOYSA-N |
| SMILES | CCC(C)N1C2=C(C=C(C=C2)N)N=C1C(F)(F)F |
Computed by PubChem (NCBI)