CAS 148000-53-7 is the registry number for 4-Amino-3,5-dinitropyridin-2-ol, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-3,5-dinitro-1H-pyridin-2-one (CAS 148000-53-7) is a chemical compound with the molecular formula C5H4N4O5 and a molecular weight of 200.11 g/mol. IUPAC name: 4-amino-3,5-dinitro-1H-pyridin-2-one. InChIKey: RGHAEKXKKLASBT-UHFFFAOYSA-N.
| Molecular formula | C5H4N4O5 |
|---|---|
| Molecular weight | 200.11 g/mol |
| IUPAC name | 4-amino-3,5-dinitro-1H-pyridin-2-one |
| InChIKey | RGHAEKXKKLASBT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=O)N1)[N+](=O)[O-])N)[N+](=O)[O-] |
Computed by PubChem (NCBI)