CAS 148021-84-5 is the registry number for (2S)-2-Amino-3-(2-fluorophenyl)propan-1-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 50mg.
(2S)-2-amino-3-(2-fluorophenyl)propan-1-ol (CAS 148021-84-5) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: (2S)-2-amino-3-(2-fluorophenyl)propan-1-ol. InChIKey: IPENTXMCVYZOPC-QMMMGPOBSA-N.
| Molecular formula | C9H12FNO |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-fluorophenyl)propan-1-ol |
| InChIKey | IPENTXMCVYZOPC-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](CO)N)F |
Computed by PubChem (NCBI)