Products 1480332-97-5

CAS 1480332-97-5 is the registry number for 2-(1-(Ethoxymethyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[1-(ethoxymethyl)-3,5-dimethylpyrazol-4-yl]acetic acid (CAS 1480332-97-5) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: 2-[1-(ethoxymethyl)-3,5-dimethylpyrazol-4-yl]acetic acid. InChIKey: YRFNSXQPZLUJFM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N2O3
Molecular weight212.25 g/mol
IUPAC name2-[1-(ethoxymethyl)-3,5-dimethylpyrazol-4-yl]acetic acid
InChIKeyYRFNSXQPZLUJFM-UHFFFAOYSA-N
SMILESCCOCN1C(=C(C(=N1)C)CC(=O)O)C

Computed by PubChem (NCBI)